C21H23F3N2OS — CID 4649647
4-[2-(2-methoxy-5-methylsulfanylphenyl)-5-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4649647) has the molecular formula C21H23F3N2OS and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-[2-(2-methoxy-5-methylsulfanylphenyl)-5-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2-methoxy-5-methylsulfanylphenyl)-5-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4649647 |
| Molecular Formula | C21H23F3N2OS |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-[2-(2-methoxy-5-methylsulfanylphenyl)-5-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(SC)cc1-c1[nH]c2ccc(C(F)(F)F)cc2c1CCCCN |
| InChI | InChI=1S/C21H23F3N2OS/c1-27-19-9-7-14(28-2)12-17(19)20-15(5-3-4-10-25)16-11-13(21(22,23)24)6-8-18(16)26-20/h6-9,11-12,26H,3-5,10,25H2,1-2H3 |
| InChIKey | FWICVXPAZKWGAV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|