C26H36N2O2 — CID 4298513
4-[5-tert-butyl-2-(3,4-diethoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4298513) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 4-[5-tert-butyl-2-(3,4-diethoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-tert-butyl-2-(3,4-diethoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4298513 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 4-[5-tert-butyl-2-(3,4-diethoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCOc1ccc(-c2[nH]c3ccc(C(C)(C)C)cc3c2CCCCN)cc1OCC |
| InChI | InChI=1S/C26H36N2O2/c1-6-29-23-14-11-18(16-24(23)30-7-2)25-20(10-8-9-15-27)21-17-19(26(3,4)5)12-13-22(21)28-25/h11-14,16-17,28H,6-10,15,27H2,1-5H3 |
| InChIKey | CMDHCLUTMHHMFO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|