C20H20ClF3N2 — CID 3615736
4-[5-chloro-2-(4-methylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3615736) has the molecular formula C20H20ClF3N2 and a molecular weight of 380.84 g/mol. Its IUPAC name is 4-[5-chloro-2-(4-methylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-chloro-2-(4-methylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3615736 |
| Molecular Formula | C20H20ClF3N2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[5-chloro-2-(4-methylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3c(C(F)(F)F)cc(Cl)cc3c2CCCCN)cc1 |
| InChI | InChI=1S/C20H20ClF3N2/c1-12-5-7-13(8-6-12)18-15(4-2-3-9-25)16-10-14(21)11-17(19(16)26-18)20(22,23)24/h5-8,10-11,26H,2-4,9,25H2,1H3 |
| InChIKey | MJYGZCPDSXWYHA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|