C19H17BrClF3N2 — CID 3688892
4-[2-(3-bromophenyl)-5-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3688892) has the molecular formula C19H17BrClF3N2 and a molecular weight of 445.71 g/mol. Its IUPAC name is 4-[2-(3-bromophenyl)-5-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3-bromophenyl)-5-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3688892 |
| Molecular Formula | C19H17BrClF3N2 |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 4-[2-(3-bromophenyl)-5-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cccc(Br)c2)[nH]c2c(C(F)(F)F)cc(Cl)cc12 |
| InChI | InChI=1S/C19H17BrClF3N2/c20-12-5-3-4-11(8-12)17-14(6-1-2-7-25)15-9-13(21)10-16(18(15)26-17)19(22,23)24/h3-5,8-10,26H,1-2,6-7,25H2 |
| InChIKey | PAWYIZGMIAREHE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|