C21H26N2 — CID 4603225
4-[5,7-dimethyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4603225) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-[5,7-dimethyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5,7-dimethyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4603225 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-[5,7-dimethyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3c(C)cc(C)cc3c2CCCCN)cc1 |
| InChI | InChI=1S/C21H26N2/c1-14-7-9-17(10-8-14)21-18(6-4-5-11-22)19-13-15(2)12-16(3)20(19)23-21/h7-10,12-13,23H,4-6,11,22H2,1-3H3 |
| InChIKey | UIAAQVXMFRCNMU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|