C19H22ClN3 — CID 4689864
4-[2-(3-chloro-4-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4689864) has the molecular formula C19H22ClN3 and a molecular weight of 327.86 g/mol. Its IUPAC name is 4-[2-(3-chloro-4-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3-chloro-4-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4689864 |
| Molecular Formula | C19H22ClN3 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[2-(3-chloro-4-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cc(C)c2[nH]c(-c3ccncc3Cl)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H22ClN3/c1-12-9-13(2)18-16(10-12)14(5-3-4-7-21)19(23-18)15-6-8-22-11-17(15)20/h6,8-11,23H,3-5,7,21H2,1-2H3 |
| InChIKey | FCMSBHCWHGCQEY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|