C18H20ClN3 — CID 3574352
4-(5-chloro-7-methyl-2-pyridin-2-yl-1H-indol-3-yl)butan-1-amine (PubChem CID 3574352) has the molecular formula C18H20ClN3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 4-(5-chloro-7-methyl-2-pyridin-2-yl-1H-indol-3-yl)butan-1-amine.
| Compound Name | 4-(5-chloro-7-methyl-2-pyridin-2-yl-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 3574352 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(5-chloro-7-methyl-2-pyridin-2-yl-1H-indol-3-yl)butan-1-amine |
| SMILES | Cc1cc(Cl)cc2c(CCCCN)c(-c3ccccn3)[nH]c12 |
| InChI | InChI=1S/C18H20ClN3/c1-12-10-13(19)11-15-14(6-2-4-8-20)18(22-17(12)15)16-7-3-5-9-21-16/h3,5,7,9-11,22H,2,4,6,8,20H2,1H3 |
| InChIKey | RYDXDYYTKTYMTO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|