C19H24N2S — CID 5140207
4-[5,7-dimethyl-2-(3-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5140207) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-[5,7-dimethyl-2-(3-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5,7-dimethyl-2-(3-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5140207 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-[5,7-dimethyl-2-(3-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cc(C)c2[nH]c(-c3sccc3C)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H24N2S/c1-12-10-14(3)17-16(11-12)15(6-4-5-8-20)18(21-17)19-13(2)7-9-22-19/h7,9-11,21H,4-6,8,20H2,1-3H3 |
| InChIKey | ZBCPMOTVPCJBTK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|