C19H18ClNO3 — CID 3934205
2-[4-chloro-2-(3-ethoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid (PubChem CID 3934205) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[4-chloro-2-(3-ethoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[4-chloro-2-(3-ethoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3934205 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[4-chloro-2-(3-ethoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1cccc(-c2[nH]c3c(C)ccc(Cl)c3c2CC(=O)O)c1 |
| InChI | InChI=1S/C19H18ClNO3/c1-3-24-13-6-4-5-12(9-13)19-14(10-16(22)23)17-15(20)8-7-11(2)18(17)21-19/h4-9,21H,3,10H2,1-2H3,(H,22,23) |
| InChIKey | FEIPWXGTAJILPQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |