C18H16BrNO2 — CID 4993473
2-[2-(3-bromophenyl)-4,7-dimethyl-1H-indol-3-yl]acetic acid (PubChem CID 4993473) has the molecular formula C18H16BrNO2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-4,7-dimethyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(3-bromophenyl)-4,7-dimethyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 4993473 |
| Molecular Formula | C18H16BrNO2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[2-(3-bromophenyl)-4,7-dimethyl-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc(C)c2c(CC(=O)O)c(-c3cccc(Br)c3)[nH]c12 |
| InChI | InChI=1S/C18H16BrNO2/c1-10-6-7-11(2)17-16(10)14(9-15(21)22)18(20-17)12-4-3-5-13(19)8-12/h3-8,20H,9H2,1-2H3,(H,21,22) |
| InChIKey | MRKZIQWRCOVKQZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |