C19H20N2O2 — CID 5008569
4-[2-(1,3-benzodioxol-5-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5008569) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5008569 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc3c(c2)OCO3)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N2O2/c20-10-4-3-6-15-14-5-1-2-7-16(14)21-19(15)13-8-9-17-18(11-13)23-12-22-17/h1-2,5,7-9,11,21H,3-4,6,10,12,20H2 |
| InChIKey | RERGQFRAYXPTKH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|