C20H22ClFN2 — CID 5217375
4-[2-(2-chloro-4-fluorophenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 5217375) has the molecular formula C20H22ClFN2 and a molecular weight of 344.86 g/mol. Its IUPAC name is 4-[2-(2-chloro-4-fluorophenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2-chloro-4-fluorophenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5217375 |
| Molecular Formula | C20H22ClFN2 |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[2-(2-chloro-4-fluorophenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc2c(CCCCN)c(-c3ccc(F)cc3Cl)[nH]c2c1C |
| InChI | InChI=1S/C20H22ClFN2/c1-12-6-8-16-15(5-3-4-10-23)20(24-19(16)13(12)2)17-9-7-14(22)11-18(17)21/h6-9,11,24H,3-5,10,23H2,1-2H3 |
| InChIKey | KCXNAINJPLQVFV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|