C19H17ClFN3 — CID 4039429
3-(4-aminobutyl)-2-(2-chloro-4-fluorophenyl)-1H-indole-5-carbonitrile (PubChem CID 4039429) has the molecular formula C19H17ClFN3 and a molecular weight of 341.82 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(2-chloro-4-fluorophenyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(4-aminobutyl)-2-(2-chloro-4-fluorophenyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 4039429 |
| Molecular Formula | C19H17ClFN3 |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-(4-aminobutyl)-2-(2-chloro-4-fluorophenyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(-c3ccc(F)cc3Cl)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H17ClFN3/c20-17-10-13(21)5-6-15(17)19-14(3-1-2-8-22)16-9-12(11-23)4-7-18(16)24-19/h4-7,9-10,24H,1-3,8,22H2 |
| InChIKey | IZZGASVUVJYYKA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|