C23H27F3N2 — CID 4989080
4-[7-butan-2-yl-2-[3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine (PubChem CID 4989080) has the molecular formula C23H27F3N2 and a molecular weight of 388.48 g/mol. Its IUPAC name is 4-[7-butan-2-yl-2-[3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-butan-2-yl-2-[3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4989080 |
| Molecular Formula | C23H27F3N2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 4-[7-butan-2-yl-2-[3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine |
| SMILES | CCC(C)c1cccc2c(CCCCN)c(-c3cccc(C(F)(F)F)c3)[nH]c12 |
| InChI | InChI=1S/C23H27F3N2/c1-3-15(2)18-11-7-12-20-19(10-4-5-13-27)21(28-22(18)20)16-8-6-9-17(14-16)23(24,25)26/h6-9,11-12,14-15,28H,3-5,10,13,27H2,1-2H3 |
| InChIKey | URRUXPPZDHIOJU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|