C18H17Cl2FN2 — CID 5140210
4-[2-(2,3-dichlorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine (PubChem CID 5140210) has the molecular formula C18H17Cl2FN2 and a molecular weight of 351.25 g/mol. Its IUPAC name is 4-[2-(2,3-dichlorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2,3-dichlorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5140210 |
| Molecular Formula | C18H17Cl2FN2 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-[2-(2,3-dichlorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cccc(Cl)c2Cl)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C18H17Cl2FN2/c19-14-8-3-7-13(16(14)20)17-11(5-1-2-10-22)12-6-4-9-15(21)18(12)23-17/h3-4,6-9,23H,1-2,5,10,22H2 |
| InChIKey | JECNXKMUAAMLKG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|