C20H16Cl2F6N2 — CID 4647984
4-[2-(2,3-dichlorophenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4647984) has the molecular formula C20H16Cl2F6N2 and a molecular weight of 469.26 g/mol. Its IUPAC name is 4-[2-(2,3-dichlorophenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2,3-dichlorophenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4647984 |
| Molecular Formula | C20H16Cl2F6N2 |
| Molecular Weight | 469.26 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 4-[2-(2,3-dichlorophenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cccc(Cl)c2Cl)[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C20H16Cl2F6N2/c21-14-6-3-5-12(17(14)22)18-11(4-1-2-7-29)16-13(20(26,27)28)8-10(19(23,24)25)9-15(16)30-18/h3,5-6,8-9,30H,1-2,4,7,29H2 |
| InChIKey | NAYAFNVMYLWGMN-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.26 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|