C19H16BrF6N3 — CID 4011886
4-[2-(5-bromo-3-pyridinyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4011886) has the molecular formula C19H16BrF6N3 and a molecular weight of 480.25 g/mol. Its IUPAC name is 4-[2-(5-bromo-3-pyridinyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-bromo-3-pyridinyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4011886 |
| Molecular Formula | C19H16BrF6N3 |
| Molecular Weight | 480.25 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 4-[2-(5-bromo-3-pyridinyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cncc(Br)c2)[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C19H16BrF6N3/c20-12-5-10(8-28-9-12)17-13(3-1-2-4-27)16-14(19(24,25)26)6-11(18(21,22)23)7-15(16)29-17/h5-9,29H,1-4,27H2 |
| InChIKey | BVJVWBJLMUIGNJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.25 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|