C18H17ClF3N3 — CID 4235880
4-[4-chloro-2-pyridin-3-yl-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4235880) has the molecular formula C18H17ClF3N3 and a molecular weight of 367.80 g/mol. Its IUPAC name is 4-[4-chloro-2-pyridin-3-yl-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4-chloro-2-pyridin-3-yl-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4235880 |
| Molecular Formula | C18H17ClF3N3 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-[4-chloro-2-pyridin-3-yl-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cccnc2)[nH]c2c(C(F)(F)F)ccc(Cl)c12 |
| InChI | InChI=1S/C18H17ClF3N3/c19-14-7-6-13(18(20,21)22)17-15(14)12(5-1-2-8-23)16(25-17)11-4-3-9-24-10-11/h3-4,6-7,9-10,25H,1-2,5,8,23H2 |
| InChIKey | TUVYTMUWQYHMGU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|