C17H18IN3 — CID 3287232
4-(5-iodo-2-pyridin-3-yl-1H-indol-3-yl)butan-1-amine (PubChem CID 3287232) has the molecular formula C17H18IN3 and a molecular weight of 391.26 g/mol. Its IUPAC name is 4-(5-iodo-2-pyridin-3-yl-1H-indol-3-yl)butan-1-amine.
| Compound Name | 4-(5-iodo-2-pyridin-3-yl-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 3287232 |
| Molecular Formula | C17H18IN3 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 4-(5-iodo-2-pyridin-3-yl-1H-indol-3-yl)butan-1-amine |
| SMILES | NCCCCc1c(-c2cccnc2)[nH]c2ccc(I)cc12 |
| InChI | InChI=1S/C17H18IN3/c18-13-6-7-16-15(10-13)14(5-1-2-8-19)17(21-16)12-4-3-9-20-11-12/h3-4,6-7,9-11,21H,1-2,5,8,19H2 |
| InChIKey | FOOUIAKLUFGHIX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|