C17H17Cl2N3 — CID 5228525
4-(4,7-dichloro-2-pyridin-4-yl-1H-indol-3-yl)butan-1-amine (PubChem CID 5228525) has the molecular formula C17H17Cl2N3 and a molecular weight of 334.25 g/mol. Its IUPAC name is 4-(4,7-dichloro-2-pyridin-4-yl-1H-indol-3-yl)butan-1-amine.
| Compound Name | 4-(4,7-dichloro-2-pyridin-4-yl-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 5228525 |
| Molecular Formula | C17H17Cl2N3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-(4,7-dichloro-2-pyridin-4-yl-1H-indol-3-yl)butan-1-amine |
| SMILES | NCCCCc1c(-c2ccncc2)[nH]c2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C17H17Cl2N3/c18-13-4-5-14(19)17-15(13)12(3-1-2-8-20)16(22-17)11-6-9-21-10-7-11/h4-7,9-10,22H,1-3,8,20H2 |
| InChIKey | KRAGRIWENJQPTD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|