C24H24BrN3O — CID 4012786
4-[2-(5-bromo-3-pyridinyl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine (PubChem CID 4012786) has the molecular formula C24H24BrN3O and a molecular weight of 450.38 g/mol. Its IUPAC name is 4-[2-(5-bromo-3-pyridinyl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-bromo-3-pyridinyl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4012786 |
| Molecular Formula | C24H24BrN3O |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4-[2-(5-bromo-3-pyridinyl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cncc(Br)c2)[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C24H24BrN3O/c25-19-12-18(14-27-15-19)24-21(8-4-5-11-26)22-13-20(9-10-23(22)28-24)29-16-17-6-2-1-3-7-17/h1-3,6-7,9-10,12-15,28H,4-5,8,11,16,26H2 |
| InChIKey | VNZBHXUHFDLMQM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|