C19H20ClN3O2 — CID 3649814
3-(4-aminobutyl)-2-(3-chloro-2-pyridinyl)-7-methyl-1H-indole-4-carboxylic acid (PubChem CID 3649814) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(3-chloro-2-pyridinyl)-7-methyl-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(3-chloro-2-pyridinyl)-7-methyl-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3649814 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3-(4-aminobutyl)-2-(3-chloro-2-pyridinyl)-7-methyl-1H-indole-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c(CCCCN)c(-c3ncccc3Cl)[nH]c12 |
| InChI | InChI=1S/C19H20ClN3O2/c1-11-7-8-13(19(24)25)15-12(5-2-3-9-21)17(23-16(11)15)18-14(20)6-4-10-22-18/h4,6-8,10,23H,2-3,5,9,21H2,1H3,(H,24,25) |
| InChIKey | JZHGEDMLPNDWDV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|