C22H19BrClN3O2 — CID 3978721
3-(4-aminobutyl)-2-(5-bromoquinolin-8-yl)-7-chloro-1H-indole-4-carboxylic acid (PubChem CID 3978721) has the molecular formula C22H19BrClN3O2 and a molecular weight of 472.77 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(5-bromoquinolin-8-yl)-7-chloro-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(5-bromoquinolin-8-yl)-7-chloro-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3978721 |
| Molecular Formula | C22H19BrClN3O2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 3-(4-aminobutyl)-2-(5-bromoquinolin-8-yl)-7-chloro-1H-indole-4-carboxylic acid |
| SMILES | NCCCCc1c(-c2ccc(Br)c3cccnc23)[nH]c2c(Cl)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C22H19BrClN3O2/c23-16-8-6-15(19-12(16)5-3-11-26-19)20-13(4-1-2-10-25)18-14(22(28)29)7-9-17(24)21(18)27-20/h3,5-9,11,27H,1-2,4,10,25H2,(H,28,29) |
| InChIKey | SKFJRQHNUNRULU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|