C22H20ClN3O2 — CID 5099964
3-(4-aminobutyl)-7-chloro-2-quinolin-8-yl-1H-indole-4-carboxylic acid (PubChem CID 5099964) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 3-(4-aminobutyl)-7-chloro-2-quinolin-8-yl-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-7-chloro-2-quinolin-8-yl-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 5099964 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-(4-aminobutyl)-7-chloro-2-quinolin-8-yl-1H-indole-4-carboxylic acid |
| SMILES | NCCCCc1c(-c2cccc3cccnc23)[nH]c2c(Cl)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C22H20ClN3O2/c23-17-10-9-15(22(27)28)18-14(7-1-2-11-24)20(26-21(17)18)16-8-3-5-13-6-4-12-25-19(13)16/h3-6,8-10,12,26H,1-2,7,11,24H2,(H,27,28) |
| InChIKey | TZMBPKMFLADTSH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|