C15H15BrClN3S — CID 3356917
4-[7-bromo-5-chloro-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3356917) has the molecular formula C15H15BrClN3S and a molecular weight of 384.73 g/mol. Its IUPAC name is 4-[7-bromo-5-chloro-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-bromo-5-chloro-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3356917 |
| Molecular Formula | C15H15BrClN3S |
| Molecular Weight | 384.73 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 4-[7-bromo-5-chloro-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2nccs2)[nH]c2c(Br)cc(Cl)cc12 |
| InChI | InChI=1S/C15H15BrClN3S/c16-12-8-9(17)7-11-10(3-1-2-4-18)14(20-13(11)12)15-19-5-6-21-15/h5-8,20H,1-4,18H2 |
| InChIKey | PKXSOSFNUNKEFC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.73 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|