C21H23NO5 — CID 3350180
2-[5,7-dimethyl-2-(2,4,5-trimethoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3350180) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[5,7-dimethyl-2-(2,4,5-trimethoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5,7-dimethyl-2-(2,4,5-trimethoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3350180 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[5,7-dimethyl-2-(2,4,5-trimethoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | COc1cc(OC)c(-c2[nH]c3c(C)cc(C)cc3c2CC(=O)O)cc1OC |
| InChI | InChI=1S/C21H23NO5/c1-11-6-12(2)20-13(7-11)14(9-19(23)24)21(22-20)15-8-17(26-4)18(27-5)10-16(15)25-3/h6-8,10,22H,9H2,1-5H3,(H,23,24) |
| InChIKey | QRRUZUBUBSRQLY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |