C14H10F2O3 — CID 151855786
2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid (PubChem CID 151855786) has the molecular formula C14H10F2O3 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid.
| Compound Name | 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 151855786 |
| Molecular Formula | C14H10F2O3 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc(F)cc2F)ccc1O |
| InChI | InChI=1S/C14H10F2O3/c15-10-2-3-11(12(16)7-10)8-1-4-13(17)9(5-8)6-14(18)19/h1-5,7,17H,6H2,(H,18,19) |
| InChIKey | SJQOWNWPLABXJP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |