2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid

C14H10F2O3 — CID 151855786

IUPAC2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc(F)cc2F)ccc1O
InChIInChI=1S/C14H10F2O3/c15-10-2-3-11(12(16)7-10)8-1-4-13(17)9(5-8)6-14(18)19/h1-5,7,17H,6H2,(H,18,19)
InChIKeySJQOWNWPLABXJP-UHFFFAOYSA-N
MW264.23 g/mol
LogP2.96
Rot. Bonds3

About 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid

2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid (PubChem CID 151855786) has the molecular formula C14H10F2O3 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid.

Molecular Properties

Compound Name2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid
PubChem CID151855786
Molecular FormulaC14H10F2O3
Molecular Weight264.23 g/mol
Exact Mass264.06
IUPAC Name2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc(F)cc2F)ccc1O
InChIInChI=1S/C14H10F2O3/c15-10-2-3-11(12(16)7-10)8-1-4-13(17)9(5-8)6-14(18)19/h1-5,7,17H,6H2,(H,18,19)
InChIKeySJQOWNWPLABXJP-UHFFFAOYSA-N
XLogP2.96
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid?
The IUPAC name of 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid (CID 151855786) is 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid.
What is the SMILES notation for 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid?
The canonical SMILES for 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid is O=C(O)Cc1cc(-c2ccc(F)cc2F)ccc1O.
What is the InChIKey of 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid?
The InChIKey is SJQOWNWPLABXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2O3/c15-10-2-3-11(12(16)7-10)8-1-4-13(17)9(5-8)6-14(18)19/h1-5,7,17H,6H2,(H,18,19).
What are the key properties of 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid?
2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid has a molecular weight of 264.23 g/mol, XLogP of 2.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,4-difluorophenyl)-2-hydroxyphenyl]acetic acid is sourced from PubChem (CID 151855786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).