C14H9F3O — CID 175647195
1-[5-(2,4-difluorophenyl)-2-fluorophenyl]ethanone (PubChem CID 175647195) has the molecular formula C14H9F3O and a molecular weight of 250.22 g/mol. Its IUPAC name is 1-[5-(2,4-difluorophenyl)-2-fluorophenyl]ethanone.
| Compound Name | 1-[5-(2,4-difluorophenyl)-2-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 175647195 |
| Molecular Formula | C14H9F3O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-[5-(2,4-difluorophenyl)-2-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(F)cc2F)ccc1F |
| InChI | InChI=1S/C14H9F3O/c1-8(18)12-6-9(2-5-13(12)16)11-4-3-10(15)7-14(11)17/h2-7H,1H3 |
| InChIKey | MEYGNRAZYLRWPU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |