C15H10F2O4S — CID 144552933
5-(2,4-difluorophenyl)-2-methylsulfanylcarbonyloxybenzoic acid (PubChem CID 144552933) has the molecular formula C15H10F2O4S and a molecular weight of 324.30 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-methylsulfanylcarbonyloxybenzoic acid.
| Compound Name | 5-(2,4-difluorophenyl)-2-methylsulfanylcarbonyloxybenzoic acid |
|---|---|
| PubChem CID | 144552933 |
| Molecular Formula | C15H10F2O4S |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-methylsulfanylcarbonyloxybenzoic acid |
| SMILES | CSC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C15H10F2O4S/c1-22-15(20)21-13-5-2-8(6-11(13)14(18)19)10-4-3-9(16)7-12(10)17/h2-7H,1H3,(H,18,19) |
| InChIKey | BGEKUZDDUBMLNI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|