C22H17F2NO3 — CID 45268306
[4-(2,4-difluorophenyl)-2-(dimethylcarbamoyl)phenyl] benzoate (PubChem CID 45268306) has the molecular formula C22H17F2NO3 and a molecular weight of 381.38 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-(dimethylcarbamoyl)phenyl] benzoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-(dimethylcarbamoyl)phenyl] benzoate |
|---|---|
| PubChem CID | 45268306 |
| Molecular Formula | C22H17F2NO3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-(dimethylcarbamoyl)phenyl] benzoate |
| SMILES | CN(C)C(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17F2NO3/c1-25(2)21(26)18-12-15(17-10-9-16(23)13-19(17)24)8-11-20(18)28-22(27)14-6-4-3-5-7-14/h3-13H,1-2H3 |
| InChIKey | KIZLRJBXUFJZNT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|