C27H19F2NO3 — CID 45268314
[2-(benzylcarbamoyl)-4-(2,4-difluorophenyl)phenyl] benzoate (PubChem CID 45268314) has the molecular formula C27H19F2NO3 and a molecular weight of 443.45 g/mol. Its IUPAC name is [2-(benzylcarbamoyl)-4-(2,4-difluorophenyl)phenyl] benzoate.
| Compound Name | [2-(benzylcarbamoyl)-4-(2,4-difluorophenyl)phenyl] benzoate |
|---|---|
| PubChem CID | 45268314 |
| Molecular Formula | C27H19F2NO3 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [2-(benzylcarbamoyl)-4-(2,4-difluorophenyl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H19F2NO3/c28-21-12-13-22(24(29)16-21)20-11-14-25(33-27(32)19-9-5-2-6-10-19)23(15-20)26(31)30-17-18-7-3-1-4-8-18/h1-16H,17H2,(H,30,31) |
| InChIKey | JZDXMQWIUAXJCY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|