C26H15Cl2F2NO3 — CID 66547484
[2-[(4-chlorophenyl)carbamoyl]-4-(2,4-difluorophenyl)phenyl] 4-chlorobenzoate (PubChem CID 66547484) has the molecular formula C26H15Cl2F2NO3 and a molecular weight of 498.31 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)carbamoyl]-4-(2,4-difluorophenyl)phenyl] 4-chlorobenzoate.
| Compound Name | [2-[(4-chlorophenyl)carbamoyl]-4-(2,4-difluorophenyl)phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 66547484 |
| Molecular Formula | C26H15Cl2F2NO3 |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | [2-[(4-chlorophenyl)carbamoyl]-4-(2,4-difluorophenyl)phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)Nc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H15Cl2F2NO3/c27-17-4-1-15(2-5-17)26(33)34-24-12-3-16(21-11-8-19(29)14-23(21)30)13-22(24)25(32)31-20-9-6-18(28)7-10-20/h1-14H,(H,31,32) |
| InChIKey | JQFSSAHAIVDKQW-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|