C16H14ClFN2O3 — CID 118707131
[4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N,N-dimethylcarbamate (PubChem CID 118707131) has the molecular formula C16H14ClFN2O3 and a molecular weight of 336.75 g/mol. Its IUPAC name is [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N,N-dimethylcarbamate.
| Compound Name | [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 118707131 |
| Molecular Formula | C16H14ClFN2O3 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [4-chloro-2-[(4-fluorophenyl)carbamoyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(Cl)cc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14ClFN2O3/c1-20(2)16(22)23-14-8-3-10(17)9-13(14)15(21)19-12-6-4-11(18)5-7-12/h3-9H,1-2H3,(H,19,21) |
| InChIKey | ULQPSHYQULWFSL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |