C27H12Cl2F6N2O5 — CID 53234258
[4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 53234258) has the molecular formula C27H12Cl2F6N2O5 and a molecular weight of 629.30 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 53234258 |
| Molecular Formula | C27H12Cl2F6N2O5 |
| Molecular Weight | 629.30 g/mol |
| Exact Mass | 628.00 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C27H12Cl2F6N2O5/c28-19-11-20(29)22(32)10-16(19)26(39)42-24-6-1-12(15-4-2-13(30)8-21(15)31)7-17(24)25(38)36-14-3-5-23(37(40)41)18(9-14)27(33,34)35/h1-11H,(H,36,38) |
| InChIKey | KFCJBIFWKZIVOL-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.30 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|