C29H19F5N2O6 — CID 53234257
[4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 5-methoxy-2-methylbenzoate (PubChem CID 53234257) has the molecular formula C29H19F5N2O6 and a molecular weight of 586.47 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 5-methoxy-2-methylbenzoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 5-methoxy-2-methylbenzoate |
|---|---|
| PubChem CID | 53234257 |
| Molecular Formula | C29H19F5N2O6 |
| Molecular Weight | 586.47 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 5-methoxy-2-methylbenzoate |
| SMILES | COc1ccc(C)c(C(=O)Oc2ccc(-c3ccc(F)cc3F)cc2C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C29H19F5N2O6/c1-15-3-7-19(41-2)14-21(15)28(38)42-26-10-4-16(20-8-5-17(30)12-24(20)31)11-22(26)27(37)35-18-6-9-25(36(39)40)23(13-18)29(32,33)34/h3-14H,1-2H3,(H,35,37) |
| InChIKey | HFRHCLZGFKFLAQ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.47 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|