C28H16ClF5N2O5 — CID 53415368
[4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2-(2-chlorophenyl)acetate (PubChem CID 53415368) has the molecular formula C28H16ClF5N2O5 and a molecular weight of 590.89 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2-(2-chlorophenyl)acetate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 53415368 |
| Molecular Formula | C28H16ClF5N2O5 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[[4-nitro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] 2-(2-chlorophenyl)acetate |
| SMILES | O=C(Cc1ccccc1Cl)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H16ClF5N2O5/c29-22-4-2-1-3-16(22)12-26(37)41-25-10-5-15(19-8-6-17(30)13-23(19)31)11-20(25)27(38)35-18-7-9-24(36(39)40)21(14-18)28(32,33)34/h1-11,13-14H,12H2,(H,35,38) |
| InChIKey | DWTILZUCBHAZNY-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|