C27H18F2N2O5 — CID 66547823
[4-(2,4-difluorophenyl)-2-[(4-methylphenyl)carbamoyl]phenyl] 4-nitrobenzoate (PubChem CID 66547823) has the molecular formula C27H18F2N2O5 and a molecular weight of 488.45 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[(4-methylphenyl)carbamoyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[(4-methylphenyl)carbamoyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 66547823 |
| Molecular Formula | C27H18F2N2O5 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[(4-methylphenyl)carbamoyl]phenyl] 4-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccc(F)cc3F)ccc2OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H18F2N2O5/c1-16-2-8-20(9-3-16)30-26(32)23-14-18(22-12-7-19(28)15-24(22)29)6-13-25(23)36-27(33)17-4-10-21(11-5-17)31(34)35/h2-15H,1H3,(H,30,32) |
| InChIKey | KFKLDLYQOYYCSB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|