C27H18ClF2NO4 — CID 66547485
[4-(2,4-difluorophenyl)-2-[(2-methoxyphenyl)carbamoyl]phenyl] 4-chlorobenzoate (PubChem CID 66547485) has the molecular formula C27H18ClF2NO4 and a molecular weight of 493.89 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[(2-methoxyphenyl)carbamoyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[(2-methoxyphenyl)carbamoyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 66547485 |
| Molecular Formula | C27H18ClF2NO4 |
| Molecular Weight | 493.89 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[(2-methoxyphenyl)carbamoyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1ccccc1NC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H18ClF2NO4/c1-34-25-5-3-2-4-23(25)31-26(32)21-14-17(20-12-11-19(29)15-22(20)30)8-13-24(21)35-27(33)16-6-9-18(28)10-7-16/h2-15H,1H3,(H,31,32) |
| InChIKey | PSDUAWBRDQALBA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|