C28H17F4NO3 — CID 77461041
[4-(2,4-difluorophenyl)-2-[(2,4-difluorophenyl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 77461041) has the molecular formula C28H17F4NO3 and a molecular weight of 491.44 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[(2,4-difluorophenyl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[(2,4-difluorophenyl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 77461041 |
| Molecular Formula | C28H17F4NO3 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[(2,4-difluorophenyl)carbamoyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C28H17F4NO3/c29-19-8-10-21(23(31)15-19)18-7-12-26(36-27(34)13-6-17-4-2-1-3-5-17)22(14-18)28(35)33-25-11-9-20(30)16-24(25)32/h1-16H,(H,33,35)/b13-6+ |
| InChIKey | GZWLKNLQUGDNCG-AWNIVKPZSA-N |
| XLogP | 6.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|