C15H10F2O4 — CID 10447030
2-acetyloxy-5-(2,4-difluorophenyl)benzoic acid (PubChem CID 10447030) has the molecular formula C15H10F2O4 and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-acetyloxy-5-(2,4-difluorophenyl)benzoic acid.
| Compound Name | 2-acetyloxy-5-(2,4-difluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 10447030 |
| Molecular Formula | C15H10F2O4 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-acetyloxy-5-(2,4-difluorophenyl)benzoic acid |
| SMILES | CC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C15H10F2O4/c1-8(18)21-14-5-2-9(6-12(14)15(19)20)11-4-3-10(16)7-13(11)17/h2-7H,1H3,(H,19,20) |
| InChIKey | LISFBZUVDUFOFV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|