C20H17F2NO7S — CID 88536099
5-(2,4-difluorophenyl)-2-[1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]sulfanylcarbonyloxybenzoic acid (PubChem CID 88536099) has the molecular formula C20H17F2NO7S and a molecular weight of 453.42 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-[1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]sulfanylcarbonyloxybenzoic acid.
| Compound Name | 5-(2,4-difluorophenyl)-2-[1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]sulfanylcarbonyloxybenzoic acid |
|---|---|
| PubChem CID | 88536099 |
| Molecular Formula | C20H17F2NO7S |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-[1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]sulfanylcarbonyloxybenzoic acid |
| SMILES | COC(=O)CNC(=O)C(C)SC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C20H17F2NO7S/c1-10(18(25)23-9-17(24)29-2)31-20(28)30-16-6-3-11(7-14(16)19(26)27)13-5-4-12(21)8-15(13)22/h3-8,10H,9H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | NPLYCLBHOUYIJP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|