C27H23F2NO7S — CID 76518405
benzyl 2-(2-acetamido-3-methoxy-3-oxopropyl)sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate (PubChem CID 76518405) has the molecular formula C27H23F2NO7S and a molecular weight of 543.54 g/mol. Its IUPAC name is benzyl 2-(2-acetamido-3-methoxy-3-oxopropyl)sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate.
| Compound Name | benzyl 2-(2-acetamido-3-methoxy-3-oxopropyl)sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate |
|---|---|
| PubChem CID | 76518405 |
| Molecular Formula | C27H23F2NO7S |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | benzyl 2-(2-acetamido-3-methoxy-3-oxopropyl)sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate |
| SMILES | COC(=O)C(CSC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)OCc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C27H23F2NO7S/c1-16(31)30-23(26(33)35-2)15-38-27(34)37-24-11-8-18(20-10-9-19(28)13-22(20)29)12-21(24)25(32)36-14-17-6-4-3-5-7-17/h3-13,23H,14-15H2,1-2H3,(H,30,31) |
| InChIKey | MCWKNJFVYGQZAH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|