C14H15NO7S — CID 59487742
2-[(2S)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylcarbonyloxybenzoic acid (PubChem CID 59487742) has the molecular formula C14H15NO7S and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[(2S)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylcarbonyloxybenzoic acid.
| Compound Name | 2-[(2S)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylcarbonyloxybenzoic acid |
|---|---|
| PubChem CID | 59487742 |
| Molecular Formula | C14H15NO7S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[(2S)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylcarbonyloxybenzoic acid |
| SMILES | COC(=O)[C@@H](CSC(=O)Oc1ccccc1C(=O)O)NC(C)=O |
| InChI | InChI=1S/C14H15NO7S/c1-8(16)15-10(13(19)21-2)7-23-14(20)22-11-6-4-3-5-9(11)12(17)18/h3-6,10H,7H2,1-2H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | FSCGBJWTBJKTPJ-SNVBAGLBSA-N |
| XLogP | 1.29 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|