C15H19NO3S — CID 175425691
methane;methyl 2-acetamido-3-(2-phenylethynylsulfanyl)propanoate (PubChem CID 175425691) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is methane;methyl 2-acetamido-3-(2-phenylethynylsulfanyl)propanoate.
| Compound Name | methane;methyl 2-acetamido-3-(2-phenylethynylsulfanyl)propanoate |
|---|---|
| PubChem CID | 175425691 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | methane;methyl 2-acetamido-3-(2-phenylethynylsulfanyl)propanoate |
| SMILES | C.COC(=O)C(CSC#Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C14H15NO3S.CH4/c1-11(16)15-13(14(17)18-2)10-19-9-8-12-6-4-3-5-7-12;/h3-7,13H,10H2,1-2H3,(H,15,16);1H4 |
| InChIKey | CQQPFLFTZBYFOD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|