C7H13NO3S — CID 13059384
methyl (2R)-2-acetamido-3-methylsulfanylpropanoate (PubChem CID 13059384) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-methylsulfanylpropanoate.
| Compound Name | methyl (2R)-2-acetamido-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 13059384 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | methyl (2R)-2-acetamido-3-methylsulfanylpropanoate |
| SMILES | COC(=O)[C@H](CSC)NC(C)=O |
| InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(4-12-3)7(10)11-2/h6H,4H2,1-3H3,(H,8,9)/t6-/m0/s1 |
| InChIKey | PVZMIVQODTYDBQ-LURJTMIESA-N |
| XLogP | 0.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |