C10H19NO4S — CID 107770169
methyl 2-acetamido-3-(3-hydroxybutan-2-ylsulfanyl)propanoate (PubChem CID 107770169) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3-hydroxybutan-2-ylsulfanyl)propanoate.
| Compound Name | methyl 2-acetamido-3-(3-hydroxybutan-2-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 107770169 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 2-acetamido-3-(3-hydroxybutan-2-ylsulfanyl)propanoate |
| SMILES | COC(=O)C(CSC(C)C(C)O)NC(C)=O |
| InChI | InChI=1S/C10H19NO4S/c1-6(12)7(2)16-5-9(10(14)15-4)11-8(3)13/h6-7,9,12H,5H2,1-4H3,(H,11,13) |
| InChIKey | UTSISZCJBGQBCX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |