C10H15NO7S — CID 155094410
2-[(2R)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylbutanedioic acid (PubChem CID 155094410) has the molecular formula C10H15NO7S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(2R)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylbutanedioic acid.
| Compound Name | 2-[(2R)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 155094410 |
| Molecular Formula | C10H15NO7S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[(2R)-2-acetamido-3-methoxy-3-oxopropyl]sulfanylbutanedioic acid |
| SMILES | COC(=O)[C@H](CSC(CC(=O)O)C(=O)O)NC(C)=O |
| InChI | InChI=1S/C10H15NO7S/c1-5(12)11-6(10(17)18-2)4-19-7(9(15)16)3-8(13)14/h6-7H,3-4H2,1-2H3,(H,11,12)(H,13,14)(H,15,16)/t6-,7?/m0/s1 |
| InChIKey | AOZIMVARQOUTRA-PKPIPKONSA-N |
| XLogP | -0.67 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |