C12H20N2O5S2 — CID 167040629
methyl 2-acetamido-3-[(2-acetamido-3-oxobutyl)disulfanyl]propanoate (PubChem CID 167040629) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is methyl 2-acetamido-3-[(2-acetamido-3-oxobutyl)disulfanyl]propanoate.
| Compound Name | methyl 2-acetamido-3-[(2-acetamido-3-oxobutyl)disulfanyl]propanoate |
|---|---|
| PubChem CID | 167040629 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl 2-acetamido-3-[(2-acetamido-3-oxobutyl)disulfanyl]propanoate |
| SMILES | COC(=O)C(CSSCC(NC(C)=O)C(C)=O)NC(C)=O |
| InChI | InChI=1S/C12H20N2O5S2/c1-7(15)10(13-8(2)16)5-20-21-6-11(12(18)19-4)14-9(3)17/h10-11H,5-6H2,1-4H3,(H,13,16)(H,14,17) |
| InChIKey | RTJKUZYXKOWHBF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|