C10H19NO3S2 — CID 176893883
methyl (2R)-2-acetamido-3-(tert-butyldisulfanyl)propanoate (PubChem CID 176893883) has the molecular formula C10H19NO3S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-(tert-butyldisulfanyl)propanoate.
| Compound Name | methyl (2R)-2-acetamido-3-(tert-butyldisulfanyl)propanoate |
|---|---|
| PubChem CID | 176893883 |
| Molecular Formula | C10H19NO3S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl (2R)-2-acetamido-3-(tert-butyldisulfanyl)propanoate |
| SMILES | COC(=O)[C@H](CSSC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C10H19NO3S2/c1-7(12)11-8(9(13)14-5)6-15-16-10(2,3)4/h8H,6H2,1-5H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | SAROLEZNHXHFTO-QMMMGPOBSA-N |
| XLogP | 1.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|