C13H23NO5S3 — CID 90192248
(2R)-3-(tert-butyldisulfanyl)-2-[[(2R)-3-methoxy-2-methyl-3-oxopropyl]sulfanylcarbonylamino]propanoic acid (PubChem CID 90192248) has the molecular formula C13H23NO5S3 and a molecular weight of 369.53 g/mol. Its IUPAC name is (2R)-3-(tert-butyldisulfanyl)-2-[[(2R)-3-methoxy-2-methyl-3-oxopropyl]sulfanylcarbonylamino]propanoic acid.
| Compound Name | (2R)-3-(tert-butyldisulfanyl)-2-[[(2R)-3-methoxy-2-methyl-3-oxopropyl]sulfanylcarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 90192248 |
| Molecular Formula | C13H23NO5S3 |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (2R)-3-(tert-butyldisulfanyl)-2-[[(2R)-3-methoxy-2-methyl-3-oxopropyl]sulfanylcarbonylamino]propanoic acid |
| SMILES | COC(=O)[C@@H](C)CSC(=O)N[C@@H](CSSC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H23NO5S3/c1-8(11(17)19-5)6-20-12(18)14-9(10(15)16)7-21-22-13(2,3)4/h8-9H,6-7H2,1-5H3,(H,14,18)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | DVHFXZMEMXKXBC-IUCAKERBSA-N |
| XLogP | 2.87 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|